Розніца паміж версіямі "Гексахларан"

1 467 байтаў дададзена ,  8 гадоў таму
няма тлумачэння праўкі
(untagged isolated.)
{{Рэчыва
[[Выява:Beta-hexachlorocyclohexane.svg|thumb]]
|загаловак =
|карцінка = [[ВыяваFile:BetaGamma-hexachlorocyclohexane.svg|thumb150 px]]
|карцінка3D = [[File:Lindane-3D.gif|150 px]]
|найменне = (1''r'',2''R'',3''S'',4''r'',5''R'',6''S'')-1,2,3,4,5,6-гексахлорцыклагексан <br /> γ-гексахлорциклогексан
|традыцыйныя назвы = Гексахларан, ліндан, 666, гексатокс, гамексан, бензолгексахларыд.
|скарачэнні = ГХЦГ
|хім. формула = C<sub>6</sub>H<sub>6</sub>Cl<sub>6</sub>
|эмпірычная формула = C 24,78 %, H 2,08 %, Cl 73,14 %
|стан = цвёрды, белы парашок, без паху
|малярная маса = 290,83 ± 0,017
|шчыльнасць = 1,87
|тэмп. плаўлення = 112,8
|тэмп. кіпення = 323
|растваральнасць = 7,3-8,5
|CAS = 58-89-9
|PubChem = 727
|EINECS = 200-401-2
|SMILES = Cl[C@H]1[C@H](Cl)[C@@H](Cl)[C@@H](Cl)[C@H](Cl)[C@H]1Cl
|ChEBI = CHEBI:32888
|ПДК = 0,05 мг/м<sup>3</sup>
|ЛД50 = 125 (мышы, унутрыбрушынны) <br /> 1200 (чалавек, пераральна)
|таксічнасць = высокатаксічны для насякомых, умерана для млекакормячых і чалавека
}}
'''Гексахларан''' C<sub>6</sub>H<sub>6</sub>Cl<sub>6</sub> — сумесь васьмі стэрэаізамераў 1,2,3,4,5,6-гексахлорцыклагексану. Усе ізамеры ўяўляюць сабой белыя крышталічныя нерастваральныя ў [[вада|вадзе]] рэчывы.
Гексахларан выклікаў адхіленні ў развіцці эмбрыёна.
 
== Гл. таксама ==
* [[Хлорарганічныя злучэнні]]
* [[Інсектыцыды]]
* [[Пестыцыды]]
 
{{Хлорарганічныя злучэнні}}
{{Надзвычай небяспечныя рэчывы}}
 
[[Катэгорыя:Інсектыцыды]]
[[Катэгорыя:Хлорарганічныя злучэнні]]